C10H16S — CID 6429946
2,5-di(propan-2-yl)thiophene (PubChem CID 6429946) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)thiophene.
| Compound Name | 2,5-di(propan-2-yl)thiophene |
|---|---|
| PubChem CID | 6429946 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2,5-di(propan-2-yl)thiophene |
| SMILES | CC(C)c1ccc(C(C)C)s1 |
| InChI | InChI=1S/C10H16S/c1-7(2)9-5-6-10(11-9)8(3)4/h5-8H,1-4H3 |
| InChIKey | BKGQPNIFUWWNOA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |