C18H32S — CID 167610872
(E)-2,5-dimethylhex-3-ene;2,5-di(propan-2-yl)thiophene (PubChem CID 167610872) has the molecular formula C18H32S and a molecular weight of 280.52 g/mol. Its IUPAC name is (E)-2,5-dimethylhex-3-ene;2,5-di(propan-2-yl)thiophene.
| Compound Name | (E)-2,5-dimethylhex-3-ene;2,5-di(propan-2-yl)thiophene |
|---|---|
| PubChem CID | 167610872 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | (E)-2,5-dimethylhex-3-ene;2,5-di(propan-2-yl)thiophene |
| SMILES | CC(C)/C=C/C(C)C.CC(C)c1ccc(C(C)C)s1 |
| InChI | InChI=1S/C10H16S.C8H16/c1-7(2)9-5-6-10(11-9)8(3)4;1-7(2)5-6-8(3)4/h5-8H,1-4H3;5-8H,1-4H3/b;6-5+ |
| InChIKey | LAIMUDFJVAEZDH-MXDQRGINSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|