C11H14O2 — CID 74763913
6-butan-2-ylcyclohepta-3,5-diene-1,2-dione (PubChem CID 74763913) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-butan-2-ylcyclohepta-3,5-diene-1,2-dione.
| Compound Name | 6-butan-2-ylcyclohepta-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 74763913 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-butan-2-ylcyclohepta-3,5-diene-1,2-dione |
| SMILES | CCC(C)C1=CC=CC(=O)C(=O)C1 |
| InChI | InChI=1S/C11H14O2/c1-3-8(2)9-5-4-6-10(12)11(13)7-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | NUKVPBLPHRZALE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|