C11H16N2O — CID 153268448
5-butan-2-yl-1,3,3a,4-tetrahydrobenzimidazol-2-one (PubChem CID 153268448) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-butan-2-yl-1,3,3a,4-tetrahydrobenzimidazol-2-one.
| Compound Name | 5-butan-2-yl-1,3,3a,4-tetrahydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 153268448 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 5-butan-2-yl-1,3,3a,4-tetrahydrobenzimidazol-2-one |
| SMILES | CCC(C)C1=CC=C2NC(=O)NC2C1 |
| InChI | InChI=1S/C11H16N2O/c1-3-7(2)8-4-5-9-10(6-8)13-11(14)12-9/h4-5,7,10H,3,6H2,1-2H3,(H2,12,13,14) |
| InChIKey | WWQKFLDHRXPBPX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |