C11H17ClN2O — CID 174957258
1,3,3a,4-tetrahydrobenzimidazol-2-one;1-chlorobutane (PubChem CID 174957258) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 1,3,3a,4-tetrahydrobenzimidazol-2-one;1-chlorobutane.
| Compound Name | 1,3,3a,4-tetrahydrobenzimidazol-2-one;1-chlorobutane |
|---|---|
| PubChem CID | 174957258 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1,3,3a,4-tetrahydrobenzimidazol-2-one;1-chlorobutane |
| SMILES | CCCCCl.O=C1NC2=CC=CCC2N1 |
| InChI | InChI=1S/C7H8N2O.C4H9Cl/c10-7-8-5-3-1-2-4-6(5)9-7;1-2-3-4-5/h1-3,6H,4H2,(H2,8,9,10);2-4H2,1H3 |
| InChIKey | SKEJRAYPJJTAFH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|