C11H16O3 — CID 89337689
2-butoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 89337689) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-butoxycyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 2-butoxycyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 89337689 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-butoxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCCOC1=CC=CCC1C(=O)O |
| InChI | InChI=1S/C11H16O3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-5,7,9H,2-3,6,8H2,1H3,(H,12,13) |
| InChIKey | KOUTUBVSQZCJHX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|