About methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate
methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate (PubChem CID 143459698) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate.
Analyze methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate?
The IUPAC name of methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate (CID 143459698) is methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate.
What is the SMILES notation for methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate?
The canonical SMILES for methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate is COC(=O)C(C)C1=CC=CCC1C.
What is the InChIKey of methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate?
The InChIKey is WEKFSWHOPYCOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-8-6-4-5-7-10(8)9(2)11(12)13-3/h4-5,7-9H,6H2,1-3H3.
What are the key properties of methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate?
methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate has a molecular weight of 180.25 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-methylcyclohexa-1,3-dien-1-yl)propanoate is sourced from PubChem (CID 143459698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).