C10H15NO2 — CID 92670417
methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate (PubChem CID 92670417) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate.
| Compound Name | methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 92670417 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate |
| SMILES | COC(=O)[C@@H](C)n1c(C)ccc1C |
| InChI | InChI=1S/C10H15NO2/c1-7-5-6-8(2)11(7)9(3)10(12)13-4/h5-6,9H,1-4H3/t9-/m1/s1 |
| InChIKey | IARRQQPOSJITIU-SECBINFHSA-N |
| XLogP | 1.84 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |