methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate

C10H15NO2 — CID 92670417

IUPACmethyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate
SMILESCOC(=O)[C@@H](C)n1c(C)ccc1C
InChIInChI=1S/C10H15NO2/c1-7-5-6-8(2)11(7)9(3)10(12)13-4/h5-6,9H,1-4H3/t9-/m1/s1
InChIKeyIARRQQPOSJITIU-SECBINFHSA-N
MW181.23 g/mol
LogP1.84
Rot. Bonds2

About methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate

methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate (PubChem CID 92670417) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate
PubChem CID92670417
Molecular FormulaC10H15NO2
Molecular Weight181.23 g/mol
Exact Mass181.11
IUPAC Namemethyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate
SMILESCOC(=O)[C@@H](C)n1c(C)ccc1C
InChIInChI=1S/C10H15NO2/c1-7-5-6-8(2)11(7)9(3)10(12)13-4/h5-6,9H,1-4H3/t9-/m1/s1
InChIKeyIARRQQPOSJITIU-SECBINFHSA-N
XLogP1.84
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.23
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate?
The IUPAC name of methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate (CID 92670417) is methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate.
What is the SMILES notation for methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate?
The canonical SMILES for methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate is COC(=O)[C@@H](C)n1c(C)ccc1C.
What is the InChIKey of methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate?
The InChIKey is IARRQQPOSJITIU-SECBINFHSA-N. The full InChI is InChI=1S/C10H15NO2/c1-7-5-6-8(2)11(7)9(3)10(12)13-4/h5-6,9H,1-4H3/t9-/m1/s1.
What are the key properties of methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate?
methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate has a molecular weight of 181.23 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(2,5-dimethylpyrrol-1-yl)propanoate is sourced from PubChem (CID 92670417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).