methyl 2-(4,5-dimethylimidazol-1-yl)propanoate

C9H14N2O2 — CID 62350544

IUPACmethyl 2-(4,5-dimethylimidazol-1-yl)propanoate
SMILESCOC(=O)C(C)n1cnc(C)c1C
InChIInChI=1S/C9H14N2O2/c1-6-7(2)11(5-10-6)8(3)9(12)13-4/h5,8H,1-4H3
InChIKeyBPPLTCNYDVHUKT-UHFFFAOYSA-N
MW182.22 g/mol
LogP1.23
Rot. Bonds2

About methyl 2-(4,5-dimethylimidazol-1-yl)propanoate

methyl 2-(4,5-dimethylimidazol-1-yl)propanoate (PubChem CID 62350544) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is methyl 2-(4,5-dimethylimidazol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(4,5-dimethylimidazol-1-yl)propanoate
PubChem CID62350544
Molecular FormulaC9H14N2O2
Molecular Weight182.22 g/mol
Exact Mass182.11
IUPAC Namemethyl 2-(4,5-dimethylimidazol-1-yl)propanoate
SMILESCOC(=O)C(C)n1cnc(C)c1C
InChIInChI=1S/C9H14N2O2/c1-6-7(2)11(5-10-6)8(3)9(12)13-4/h5,8H,1-4H3
InChIKeyBPPLTCNYDVHUKT-UHFFFAOYSA-N
XLogP1.23
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 51.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4,5-dimethylimidazol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,5-dimethylimidazol-1-yl)propanoate?
The IUPAC name of methyl 2-(4,5-dimethylimidazol-1-yl)propanoate (CID 62350544) is methyl 2-(4,5-dimethylimidazol-1-yl)propanoate.
What is the SMILES notation for methyl 2-(4,5-dimethylimidazol-1-yl)propanoate?
The canonical SMILES for methyl 2-(4,5-dimethylimidazol-1-yl)propanoate is COC(=O)C(C)n1cnc(C)c1C.
What is the InChIKey of methyl 2-(4,5-dimethylimidazol-1-yl)propanoate?
The InChIKey is BPPLTCNYDVHUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6-7(2)11(5-10-6)8(3)9(12)13-4/h5,8H,1-4H3.
What are the key properties of methyl 2-(4,5-dimethylimidazol-1-yl)propanoate?
methyl 2-(4,5-dimethylimidazol-1-yl)propanoate has a molecular weight of 182.22 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5-dimethylimidazol-1-yl)propanoate is sourced from PubChem (CID 62350544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).