C14H17FN4O — CID 62349835
N-(5-amino-2-fluorophenyl)-2-(4,5-dimethylimidazol-1-yl)propanamide (PubChem CID 62349835) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(4,5-dimethylimidazol-1-yl)propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(4,5-dimethylimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 62349835 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(4,5-dimethylimidazol-1-yl)propanamide |
| SMILES | Cc1ncn(C(C)C(=O)Nc2cc(N)ccc2F)c1C |
| InChI | InChI=1S/C14H17FN4O/c1-8-9(2)19(7-17-8)10(3)14(20)18-13-6-11(16)4-5-12(13)15/h4-7,10H,16H2,1-3H3,(H,18,20) |
| InChIKey | WZZXINLPPCYGTF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|