C8H14N4O — CID 62352168
2-(4,5-dimethylimidazol-1-yl)-N'-hydroxypropanimidamide (PubChem CID 62352168) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-N'-hydroxypropanimidamide.
| Compound Name | 2-(4,5-dimethylimidazol-1-yl)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 62352168 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(4,5-dimethylimidazol-1-yl)-N'-hydroxypropanimidamide |
| SMILES | Cc1ncn(C(C)/C(N)=N/O)c1C |
| InChI | InChI=1S/C8H14N4O/c1-5-6(2)12(4-10-5)7(3)8(9)11-13/h4,7,13H,1-3H3,(H2,9,11) |
| InChIKey | BEAPPFDEVQXXOR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|