C10H22N6O2 — CID 87561124
2-[4-[(1E)-1-amino-1-hydroxyiminopropan-2-yl]piperazin-1-yl]-N'-hydroxypropanimidamide (PubChem CID 87561124) has the molecular formula C10H22N6O2 and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-[4-[(1E)-1-amino-1-hydroxyiminopropan-2-yl]piperazin-1-yl]-N'-hydroxypropanimidamide.
| Compound Name | 2-[4-[(1E)-1-amino-1-hydroxyiminopropan-2-yl]piperazin-1-yl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 87561124 |
| Molecular Formula | C10H22N6O2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[4-[(1E)-1-amino-1-hydroxyiminopropan-2-yl]piperazin-1-yl]-N'-hydroxypropanimidamide |
| SMILES | CC(/C(N)=N\O)N1CCN(C(C)/C(N)=N\O)CC1 |
| InChI | InChI=1S/C10H22N6O2/c1-7(9(11)13-17)15-3-5-16(6-4-15)8(2)10(12)14-18/h7-8,17-18H,3-6H2,1-2H3,(H2,11,13)(H2,12,14) |
| InChIKey | QAFLVXONPPBEQR-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|