C7H15N3O3 — CID 106669726
2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxypropanimidamide (PubChem CID 106669726) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxypropanimidamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 106669726 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxypropanimidamide |
| SMILES | CC(C(N)=NO)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C7H15N3O3/c1-4(7(8)9-13)10-2-5(11)6(12)3-10/h4-6,11-13H,2-3H2,1H3,(H2,8,9) |
| InChIKey | BDCWZRMYNSJQOC-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|