C10H22N4O — CID 81464616
2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N'-hydroxypropanimidamide (PubChem CID 81464616) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N'-hydroxypropanimidamide.
| Compound Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 81464616 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-N'-hydroxypropanimidamide |
| SMILES | CC1CN(C(C)C(N)=NO)CC1N(C)C |
| InChI | InChI=1S/C10H22N4O/c1-7-5-14(6-9(7)13(3)4)8(2)10(11)12-15/h7-9,15H,5-6H2,1-4H3,(H2,11,12) |
| InChIKey | VEGNEDQSGVYLOU-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|