C11H23N3S — CID 81464140
2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]butanethioamide (PubChem CID 81464140) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]butanethioamide.
| Compound Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 81464140 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CC(C)C(N(C)C)C1 |
| InChI | InChI=1S/C11H23N3S/c1-5-9(11(12)15)14-6-8(2)10(7-14)13(3)4/h8-10H,5-7H2,1-4H3,(H2,12,15) |
| InChIKey | HUNHCUMKARQWMI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|