C11H20F3N3S — CID 103368799
2-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368799) has the molecular formula C11H20F3N3S and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368799 |
| Molecular Formula | C11H20F3N3S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CC1CN(CC(C(N)=S)C(F)(F)F)CC1N(C)C |
| InChI | InChI=1S/C11H20F3N3S/c1-7-4-17(6-9(7)16(2)3)5-8(10(15)18)11(12,13)14/h7-9H,4-6H2,1-3H3,(H2,15,18) |
| InChIKey | WDYPEFJIMWHSDY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|