C11H19F3N2S — CID 103368831
2-[(3,4-dimethylpiperidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368831) has the molecular formula C11H19F3N2S and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(3,4-dimethylpiperidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368831 |
| Molecular Formula | C11H19F3N2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[(3,4-dimethylpiperidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CC1CCN(CC(C(N)=S)C(F)(F)F)CC1C |
| InChI | InChI=1S/C11H19F3N2S/c1-7-3-4-16(5-8(7)2)6-9(10(15)17)11(12,13)14/h7-9H,3-6H2,1-2H3,(H2,15,17) |
| InChIKey | NRSTVJRATWLEMI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|