C10H20N4O4S — CID 77015089
N'-hydroxy-2-[4-(2-methylsulfonylacetyl)piperazin-1-yl]propanimidamide (PubChem CID 77015089) has the molecular formula C10H20N4O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(2-methylsulfonylacetyl)piperazin-1-yl]propanimidamide.
| Compound Name | N'-hydroxy-2-[4-(2-methylsulfonylacetyl)piperazin-1-yl]propanimidamide |
|---|---|
| PubChem CID | 77015089 |
| Molecular Formula | C10H20N4O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N'-hydroxy-2-[4-(2-methylsulfonylacetyl)piperazin-1-yl]propanimidamide |
| SMILES | CC(C(N)=NO)N1CCN(C(=O)CS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H20N4O4S/c1-8(10(11)12-16)13-3-5-14(6-4-13)9(15)7-19(2,17)18/h8,16H,3-7H2,1-2H3,(H2,11,12) |
| InChIKey | IJHYLRIILCUWHK-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|