C10H21N5O5S — CID 104929373
ethyl N-[4-(1-amino-1-hydroxyiminopropan-2-yl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 104929373) has the molecular formula C10H21N5O5S and a molecular weight of 323.38 g/mol. Its IUPAC name is ethyl N-[4-(1-amino-1-hydroxyiminopropan-2-yl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[4-(1-amino-1-hydroxyiminopropan-2-yl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 104929373 |
| Molecular Formula | C10H21N5O5S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | ethyl N-[4-(1-amino-1-hydroxyiminopropan-2-yl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCN(C(C)C(N)=NO)CC1 |
| InChI | InChI=1S/C10H21N5O5S/c1-3-20-10(16)13-21(18,19)15-6-4-14(5-7-15)8(2)9(11)12-17/h8,17H,3-7H2,1-2H3,(H2,11,12)(H,13,16) |
| InChIKey | JGRPWSOSPRNKLV-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|