C9H18N4O4S2 — CID 114463635
ethyl N-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 114463635) has the molecular formula C9H18N4O4S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is ethyl N-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114463635 |
| Molecular Formula | C9H18N4O4S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | ethyl N-[4-(2-amino-2-sulfanylideneethyl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C9H18N4O4S2/c1-2-17-9(14)11-19(15,16)13-5-3-12(4-6-13)7-8(10)18/h2-7H2,1H3,(H2,10,18)(H,11,14) |
| InChIKey | LERVKXIHRCBNNJ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|