C10H22N4O4S — CID 114461191
methyl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 114461191) has the molecular formula C10H22N4O4S and a molecular weight of 294.38 g/mol. Its IUPAC name is methyl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | methyl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114461191 |
| Molecular Formula | C10H22N4O4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | methyl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCN(CCCCN)CC1 |
| InChI | InChI=1S/C10H22N4O4S/c1-18-10(15)12-19(16,17)14-8-6-13(7-9-14)5-3-2-4-11/h2-9,11H2,1H3,(H,12,15) |
| InChIKey | YTRCEMBALGYKFG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|