C12H26N4O4S — CID 114461189
propan-2-yl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate (PubChem CID 114461189) has the molecular formula C12H26N4O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is propan-2-yl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate.
| Compound Name | propan-2-yl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114461189 |
| Molecular Formula | C12H26N4O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | propan-2-yl N-[4-(4-aminobutyl)piperazin-1-yl]sulfonylcarbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N1CCN(CCCCN)CC1 |
| InChI | InChI=1S/C12H26N4O4S/c1-11(2)20-12(17)14-21(18,19)16-9-7-15(8-10-16)6-4-3-5-13/h11H,3-10,13H2,1-2H3,(H,14,17) |
| InChIKey | YICJODBCXXGUPX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|