C11H24N4O4S — CID 114461831
propan-2-yl N-(3-piperazin-1-ylpropylsulfamoyl)carbamate (PubChem CID 114461831) has the molecular formula C11H24N4O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is propan-2-yl N-(3-piperazin-1-ylpropylsulfamoyl)carbamate.
| Compound Name | propan-2-yl N-(3-piperazin-1-ylpropylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114461831 |
| Molecular Formula | C11H24N4O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | propan-2-yl N-(3-piperazin-1-ylpropylsulfamoyl)carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C11H24N4O4S/c1-10(2)19-11(16)14-20(17,18)13-4-3-7-15-8-5-12-6-9-15/h10,12-13H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | RLXDMYYCIOHDED-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|