C6H13ClN2O6S2 — CID 114467593
propan-2-yl N-(2-chlorosulfonylethylsulfamoyl)carbamate (PubChem CID 114467593) has the molecular formula C6H13ClN2O6S2 and a molecular weight of 308.77 g/mol. Its IUPAC name is propan-2-yl N-(2-chlorosulfonylethylsulfamoyl)carbamate.
| Compound Name | propan-2-yl N-(2-chlorosulfonylethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114467593 |
| Molecular Formula | C6H13ClN2O6S2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | propan-2-yl N-(2-chlorosulfonylethylsulfamoyl)carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCCS(=O)(=O)Cl |
| InChI | InChI=1S/C6H13ClN2O6S2/c1-5(2)15-6(10)9-17(13,14)8-3-4-16(7,11)12/h5,8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | XGGWQIQFDROQDI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |