C9H20N4O5S — CID 104929393
propan-2-yl N-[(5-amino-5-hydroxyiminopentyl)sulfamoyl]carbamate (PubChem CID 104929393) has the molecular formula C9H20N4O5S and a molecular weight of 296.35 g/mol. Its IUPAC name is propan-2-yl N-[(5-amino-5-hydroxyiminopentyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(5-amino-5-hydroxyiminopentyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 104929393 |
| Molecular Formula | C9H20N4O5S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | propan-2-yl N-[(5-amino-5-hydroxyiminopentyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCCCCC(N)=NO |
| InChI | InChI=1S/C9H20N4O5S/c1-7(2)18-9(14)13-19(16,17)11-6-4-3-5-8(10)12-15/h7,11,15H,3-6H2,1-2H3,(H2,10,12)(H,13,14) |
| InChIKey | UZPCGIHKJAYODD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|