C11H23N3O2 — CID 77036898
N-(5-amino-5-hydroxyiminopentyl)-4-methylpentanamide (PubChem CID 77036898) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(5-amino-5-hydroxyiminopentyl)-4-methylpentanamide.
| Compound Name | N-(5-amino-5-hydroxyiminopentyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 77036898 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(5-amino-5-hydroxyiminopentyl)-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCCCCC(N)=NO |
| InChI | InChI=1S/C11H23N3O2/c1-9(2)6-7-11(15)13-8-4-3-5-10(12)14-16/h9,16H,3-8H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | DIQAAGFZAZONQC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|