C11H22BrNO — CID 106131429
N-(4-bromopentyl)-4-methylpentanamide (PubChem CID 106131429) has the molecular formula C11H22BrNO and a molecular weight of 264.21 g/mol. Its IUPAC name is N-(4-bromopentyl)-4-methylpentanamide.
| Compound Name | N-(4-bromopentyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 106131429 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-(4-bromopentyl)-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCCCC(C)Br |
| InChI | InChI=1S/C11H22BrNO/c1-9(2)6-7-11(14)13-8-4-5-10(3)12/h9-10H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | KPTGLZKGGXOJAA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|