C9H21N3O4S — CID 79593807
N'-hydroxy-4-(2-propan-2-yloxyethylsulfonylamino)butanimidamide (PubChem CID 79593807) has the molecular formula C9H21N3O4S and a molecular weight of 267.35 g/mol. Its IUPAC name is N'-hydroxy-4-(2-propan-2-yloxyethylsulfonylamino)butanimidamide.
| Compound Name | N'-hydroxy-4-(2-propan-2-yloxyethylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 79593807 |
| Molecular Formula | C9H21N3O4S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N'-hydroxy-4-(2-propan-2-yloxyethylsulfonylamino)butanimidamide |
| SMILES | CC(C)OCCS(=O)(=O)NCCCC(N)=NO |
| InChI | InChI=1S/C9H21N3O4S/c1-8(2)16-6-7-17(14,15)11-5-3-4-9(10)12-13/h8,11,13H,3-7H2,1-2H3,(H2,10,12) |
| InChIKey | NMUAFUIIJBGMIV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|