C17H36Cl2N4O — CID 119392993
3-methyl-N-(3-piperazin-1-ylpropyl)-2-piperidin-1-ylbutanamide;dihydrochloride (PubChem CID 119392993) has the molecular formula C17H36Cl2N4O and a molecular weight of 383.41 g/mol. Its IUPAC name is 3-methyl-N-(3-piperazin-1-ylpropyl)-2-piperidin-1-ylbutanamide;dihydrochloride.
| Compound Name | 3-methyl-N-(3-piperazin-1-ylpropyl)-2-piperidin-1-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119392993 |
| Molecular Formula | C17H36Cl2N4O |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-methyl-N-(3-piperazin-1-ylpropyl)-2-piperidin-1-ylbutanamide;dihydrochloride |
| SMILES | CC(C)C(C(=O)NCCCN1CCNCC1)N1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C17H34N4O.2ClH/c1-15(2)16(21-11-4-3-5-12-21)17(22)19-7-6-10-20-13-8-18-9-14-20;;/h15-16,18H,3-14H2,1-2H3,(H,19,22);2*1H |
| InChIKey | MKRNLGURMUTMPR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|