C11H23N3O4S — CID 114464874
propan-2-yl N-[4-(2-aminoethyl)piperidin-1-yl]sulfonylcarbamate (PubChem CID 114464874) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is propan-2-yl N-[4-(2-aminoethyl)piperidin-1-yl]sulfonylcarbamate.
| Compound Name | propan-2-yl N-[4-(2-aminoethyl)piperidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 114464874 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | propan-2-yl N-[4-(2-aminoethyl)piperidin-1-yl]sulfonylcarbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N1CCC(CCN)CC1 |
| InChI | InChI=1S/C11H23N3O4S/c1-9(2)18-11(15)13-19(16,17)14-7-4-10(3-6-12)5-8-14/h9-10H,3-8,12H2,1-2H3,(H,13,15) |
| InChIKey | GGPNEFDEAHPXCO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |