C17H34N4O5S2 — CID 134126316
1,3-bis[(4-propylpiperidin-1-yl)sulfonyl]urea (PubChem CID 134126316) has the molecular formula C17H34N4O5S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 1,3-bis[(4-propylpiperidin-1-yl)sulfonyl]urea.
| Compound Name | 1,3-bis[(4-propylpiperidin-1-yl)sulfonyl]urea |
|---|---|
| PubChem CID | 134126316 |
| Molecular Formula | C17H34N4O5S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1,3-bis[(4-propylpiperidin-1-yl)sulfonyl]urea |
| SMILES | CCCC1CCN(S(=O)(=O)NC(=O)NS(=O)(=O)N2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C17H34N4O5S2/c1-3-5-15-7-11-20(12-8-15)27(23,24)18-17(22)19-28(25,26)21-13-9-16(6-4-2)10-14-21/h15-16H,3-14H2,1-2H3,(H2,18,19,22) |
| InChIKey | DKJZZQHNNVDBRC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |