C7H12F2N2O4S — CID 168931490
methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate (PubChem CID 168931490) has the molecular formula C7H12F2N2O4S and a molecular weight of 258.25 g/mol. Its IUPAC name is methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate.
| Compound Name | methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate |
|---|---|
| PubChem CID | 168931490 |
| Molecular Formula | C7H12F2N2O4S |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H12F2N2O4S/c1-15-6(12)10-16(13,14)11-4-2-7(8,9)3-5-11/h2-5H2,1H3,(H,10,12) |
| InChIKey | KSDBCBLPWWSWRK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |