methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate

C7H12F2N2O4S — CID 168931490

IUPACmethyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate
SMILESCOC(=O)NS(=O)(=O)N1CCC(F)(F)CC1
InChIInChI=1S/C7H12F2N2O4S/c1-15-6(12)10-16(13,14)11-4-2-7(8,9)3-5-11/h2-5H2,1H3,(H,10,12)
InChIKeyKSDBCBLPWWSWRK-UHFFFAOYSA-N
MW258.25 g/mol
LogP0.32
Rot. Bonds2

About methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate

methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate (PubChem CID 168931490) has the molecular formula C7H12F2N2O4S and a molecular weight of 258.25 g/mol. Its IUPAC name is methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate.

Molecular Properties

Compound Namemethyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate
PubChem CID168931490
Molecular FormulaC7H12F2N2O4S
Molecular Weight258.25 g/mol
Exact Mass258.05
IUPAC Namemethyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate
SMILESCOC(=O)NS(=O)(=O)N1CCC(F)(F)CC1
InChIInChI=1S/C7H12F2N2O4S/c1-15-6(12)10-16(13,14)11-4-2-7(8,9)3-5-11/h2-5H2,1H3,(H,10,12)
InChIKeyKSDBCBLPWWSWRK-UHFFFAOYSA-N
XLogP0.32
TPSA75.71 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.25
LogP ≤ 50.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate?
The IUPAC name of methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate (CID 168931490) is methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate.
What is the SMILES notation for methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate?
The canonical SMILES for methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate is COC(=O)NS(=O)(=O)N1CCC(F)(F)CC1.
What is the InChIKey of methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate?
The InChIKey is KSDBCBLPWWSWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O4S/c1-15-6(12)10-16(13,14)11-4-2-7(8,9)3-5-11/h2-5H2,1H3,(H,10,12).
What are the key properties of methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate?
methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate has a molecular weight of 258.25 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4,4-difluoropiperidin-1-yl)sulfonylcarbamate is sourced from PubChem (CID 168931490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).