C8H12N4O6S — CID 114464555
methyl N-[(2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl)sulfonyl]carbamate (PubChem CID 114464555) has the molecular formula C8H12N4O6S and a molecular weight of 292.27 g/mol. Its IUPAC name is methyl N-[(2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl)sulfonyl]carbamate.
| Compound Name | methyl N-[(2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl)sulfonyl]carbamate |
|---|---|
| PubChem CID | 114464555 |
| Molecular Formula | C8H12N4O6S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | methyl N-[(2,4-dioxo-1,3,7-triazaspiro[4.4]nonan-7-yl)sulfonyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C8H12N4O6S/c1-18-7(15)11-19(16,17)12-3-2-8(4-12)5(13)9-6(14)10-8/h2-4H2,1H3,(H,11,15)(H2,9,10,13,14) |
| InChIKey | LFUAGQXYNDWMJK-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|