C9H16N4O5S — CID 114815935
N-(2-methoxyethyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-sulfonamide (PubChem CID 114815935) has the molecular formula C9H16N4O5S and a molecular weight of 292.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-sulfonamide |
|---|---|
| PubChem CID | 114815935 |
| Molecular Formula | C9H16N4O5S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-(2-methoxyethyl)-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-sulfonamide |
| SMILES | COCCNS(=O)(=O)N1CCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C9H16N4O5S/c1-18-5-3-10-19(16,17)13-4-2-9(6-13)7(14)11-8(15)12-9/h10H,2-6H2,1H3,(H2,11,12,14,15) |
| InChIKey | VXHGNVOGHRPLIG-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|