About 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide
2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide (PubChem CID 116621752) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide.
Analyze 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide?
The IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide (CID 116621752) is 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide.
What is the SMILES notation for 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide?
The canonical SMILES for 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide is Cc1ncn(C(C)C(=O)N(C)C)c1C.
What is the InChIKey of 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide?
The InChIKey is BEVSJWPKMHDAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-7-8(2)13(6-11-7)9(3)10(14)12(4)5/h6,9H,1-5H3.
What are the key properties of 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide?
2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide has a molecular weight of 195.27 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylimidazol-1-yl)-N,N-dimethylpropanamide is sourced from PubChem (CID 116621752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).