C6H10N4O — CID 59693974
N,N,1-trimethyl-1,2,4-triazole-3-carboxamide (PubChem CID 59693974) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is N,N,1-trimethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N,N,1-trimethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 59693974 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N,N,1-trimethyl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1ncn(C)n1 |
| InChI | InChI=1S/C6H10N4O/c1-9(2)6(11)5-7-4-10(3)8-5/h4H,1-3H3 |
| InChIKey | OKZVZMOEMHJPIN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |