C15H13F2N7O2 — CID 178112536
N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-N,1-dimethyl-1,2,4-triazole-3-carboxamide (PubChem CID 178112536) has the molecular formula C15H13F2N7O2 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-N,1-dimethyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-N,1-dimethyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 178112536 |
| Molecular Formula | C15H13F2N7O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-N,1-dimethyl-1,2,4-triazole-3-carboxamide |
| SMILES | CN(/N=C/c1ccc(-c2nnc(C(F)F)o2)cc1)C(=O)c1ncn(C)n1 |
| InChI | InChI=1S/C15H13F2N7O2/c1-23-8-18-12(22-23)15(25)24(2)19-7-9-3-5-10(6-4-9)13-20-21-14(26-13)11(16)17/h3-8,11H,1-2H3/b19-7+ |
| InChIKey | VYSRJICFOOBLJU-FBCYGCLPSA-N |
| XLogP | 1.91 |
| TPSA | 102.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|