C19H12F6N4O2 — CID 178112527
N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-5-fluoro-N-methyl-2-(trifluoromethyl)benzamide (PubChem CID 178112527) has the molecular formula C19H12F6N4O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-5-fluoro-N-methyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-5-fluoro-N-methyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 178112527 |
| Molecular Formula | C19H12F6N4O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methylideneamino]-5-fluoro-N-methyl-2-(trifluoromethyl)benzamide |
| SMILES | CN(/N=C/c1ccc(-c2nnc(C(F)F)o2)cc1)C(=O)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C19H12F6N4O2/c1-29(18(30)13-8-12(20)6-7-14(13)19(23,24)25)26-9-10-2-4-11(5-3-10)16-27-28-17(31-16)15(21)22/h2-9,15H,1H3/b26-9+ |
| InChIKey | FBDMLPPCLCZLAQ-JQAMDZJQSA-N |
| XLogP | 4.94 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|