C21H16F5N5O2 — CID 178112239
2-(3,3-difluoroazetidin-1-yl)-N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methylideneamino]-N-methylbenzamide (PubChem CID 178112239) has the molecular formula C21H16F5N5O2 and a molecular weight of 465.38 g/mol. Its IUPAC name is 2-(3,3-difluoroazetidin-1-yl)-N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methylideneamino]-N-methylbenzamide.
| Compound Name | 2-(3,3-difluoroazetidin-1-yl)-N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methylideneamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 178112239 |
| Molecular Formula | C21H16F5N5O2 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-(3,3-difluoroazetidin-1-yl)-N-[(E)-[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methylideneamino]-N-methylbenzamide |
| SMILES | CN(/N=C/c1ccc(-c2nnc(C(F)F)o2)cc1F)C(=O)c1ccccc1N1CC(F)(F)C1 |
| InChI | InChI=1S/C21H16F5N5O2/c1-30(20(32)14-4-2-3-5-16(14)31-10-21(25,26)11-31)27-9-13-7-6-12(8-15(13)22)18-28-29-19(33-18)17(23)24/h2-9,17H,10-11H2,1H3/b27-9+ |
| InChIKey | RGEDFNJXGSZOGP-OXUBWTJQSA-N |
| XLogP | 4.37 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|