methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate

C11H18N2O3 — CID 170887419

IUPACmethyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate
SMILESCOC(=O)C(C)n1nc(C)c(CCO)c1C
InChIInChI=1S/C11H18N2O3/c1-7-10(5-6-14)8(2)13(12-7)9(3)11(15)16-4/h9,14H,5-6H2,1-4H3
InChIKeyBSGZABFTRJUVMK-UHFFFAOYSA-N
MW226.28 g/mol
LogP0.77
Rot. Bonds4

About methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate

methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate (PubChem CID 170887419) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate.

Molecular Properties

Compound Namemethyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate
PubChem CID170887419
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Namemethyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate
SMILESCOC(=O)C(C)n1nc(C)c(CCO)c1C
InChIInChI=1S/C11H18N2O3/c1-7-10(5-6-14)8(2)13(12-7)9(3)11(15)16-4/h9,14H,5-6H2,1-4H3
InChIKeyBSGZABFTRJUVMK-UHFFFAOYSA-N
XLogP0.77
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 50.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate?
The IUPAC name of methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate (CID 170887419) is methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate.
What is the SMILES notation for methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate?
The canonical SMILES for methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate is COC(=O)C(C)n1nc(C)c(CCO)c1C.
What is the InChIKey of methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate?
The InChIKey is BSGZABFTRJUVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-7-10(5-6-14)8(2)13(12-7)9(3)11(15)16-4/h9,14H,5-6H2,1-4H3.
What are the key properties of methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate?
methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate has a molecular weight of 226.28 g/mol, XLogP of 0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(2-hydroxyethyl)-3,5-dimethylpyrazol-1-yl]propanoate is sourced from PubChem (CID 170887419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).