About ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate
ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate (PubChem CID 106676934) has the molecular formula C17H22N2O2
and a molecular weight of 286.38 g/mol. Its IUPAC name is ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate.
Molecular Properties
| Compound Name | ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate |
| PubChem CID | 106676934 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)n1nc(C)c(CC)c1C |
| InChI | InChI=1S/C17H22N2O2/c1-5-15-12(3)18-19(13(15)4)16(17(20)21-6-2)14-10-8-7-9-11-14/h7-11,16H,5-6H2,1-4H3 |
| InChIKey | SCDRQWHULKWMPJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate?
The IUPAC name of ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate (CID 106676934) is ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate.
What is the SMILES notation for ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate?
The canonical SMILES for ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate is CCOC(=O)C(c1ccccc1)n1nc(C)c(CC)c1C.
What is the InChIKey of ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate?
The InChIKey is SCDRQWHULKWMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2/c1-5-15-12(3)18-19(13(15)4)16(17(20)21-6-2)14-10-8-7-9-11-14/h7-11,16H,5-6H2,1-4H3.
What are the key properties of ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate?
ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate has a molecular weight of 286.38 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylacetate is sourced from PubChem (CID 106676934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).