C16H20N2O2 — CID 63074617
3-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylpropanoic acid (PubChem CID 63074617) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylpropanoic acid.
| Compound Name | 3-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 63074617 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-(4-ethyl-3,5-dimethylpyrazol-1-yl)-2-phenylpropanoic acid |
| SMILES | CCc1c(C)nn(CC(C(=O)O)c2ccccc2)c1C |
| InChI | InChI=1S/C16H20N2O2/c1-4-14-11(2)17-18(12(14)3)10-15(16(19)20)13-8-6-5-7-9-13/h5-9,15H,4,10H2,1-3H3,(H,19,20) |
| InChIKey | RYQCQEURXGXCCC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |