C12H12N4O4 — CID 106676929
ethyl 2-(3-nitro-1,2,4-triazol-1-yl)-2-phenylacetate (PubChem CID 106676929) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is ethyl 2-(3-nitro-1,2,4-triazol-1-yl)-2-phenylacetate.
| Compound Name | ethyl 2-(3-nitro-1,2,4-triazol-1-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 106676929 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | ethyl 2-(3-nitro-1,2,4-triazol-1-yl)-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)n1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H12N4O4/c1-2-20-11(17)10(9-6-4-3-5-7-9)15-8-13-12(14-15)16(18)19/h3-8,10H,2H2,1H3 |
| InChIKey | KIOAMGVQFKNTPA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|