C15H13I2NO3 — CID 92643637
ethyl (2R)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-2-phenylacetate (PubChem CID 92643637) has the molecular formula C15H13I2NO3 and a molecular weight of 509.08 g/mol. Its IUPAC name is ethyl (2R)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-2-phenylacetate.
| Compound Name | ethyl (2R)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-2-phenylacetate |
|---|---|
| PubChem CID | 92643637 |
| Molecular Formula | C15H13I2NO3 |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.90 |
| IUPAC Name | ethyl (2R)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-2-phenylacetate |
| SMILES | CCOC(=O)[C@@H](c1ccccc1)n1cc(I)c(=O)c(I)c1 |
| InChI | InChI=1S/C15H13I2NO3/c1-2-21-15(20)13(10-6-4-3-5-7-10)18-8-11(16)14(19)12(17)9-18/h3-9,13H,2H2,1H3/t13-/m1/s1 |
| InChIKey | SUTVPZANEGPWEQ-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|