C14H13FO — CID 172566196
4-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)benzaldehyde (PubChem CID 172566196) has the molecular formula C14H13FO and a molecular weight of 216.25 g/mol. Its IUPAC name is 4-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)benzaldehyde.
| Compound Name | 4-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 172566196 |
| Molecular Formula | C14H13FO |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)benzaldehyde |
| SMILES | CC1C=C(F)C=CC1c1ccc(C=O)cc1 |
| InChI | InChI=1S/C14H13FO/c1-10-8-13(15)6-7-14(10)12-4-2-11(9-16)3-5-12/h2-10,14H,1H3 |
| InChIKey | ZVSHDRGTZKNEFI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|