C8H12O2S — CID 147676274
3,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid (PubChem CID 147676274) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 3,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid.
| Compound Name | 3,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid |
|---|---|
| PubChem CID | 147676274 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3,4-dimethylcyclohexa-1,5-diene-1-sulfinic acid |
| SMILES | CC1C=CC(S(=O)O)=CC1C |
| InChI | InChI=1S/C8H12O2S/c1-6-3-4-8(11(9)10)5-7(6)2/h3-7H,1-2H3,(H,9,10) |
| InChIKey | FOTBTHHDBLFKPG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|