About 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile
3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile (PubChem CID 138579394) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile.
Analyze 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile?
The IUPAC name of 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile (CID 138579394) is 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile.
What is the SMILES notation for 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile?
The canonical SMILES for 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile is CC(=O)C1C=C(C#N)C=NC1C.
What is the InChIKey of 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile?
The InChIKey is YTCYLDDOMUSCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-6-9(7(2)12)3-8(4-10)5-11-6/h3,5-6,9H,1-2H3.
What are the key properties of 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile?
3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile has a molecular weight of 162.19 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-methyl-2,3-dihydropyridine-5-carbonitrile is sourced from PubChem (CID 138579394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).