About 5-hydroxycyclohexa-1,5-diene-1-carboxamide
5-hydroxycyclohexa-1,5-diene-1-carboxamide (PubChem CID 89094730) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 5-hydroxycyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 5-hydroxycyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 89094730 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 5-hydroxycyclohexa-1,5-diene-1-carboxamide |
| SMILES | NC(=O)C1=CCCC(O)=C1 |
| InChI | InChI=1S/C7H9NO2/c8-7(10)5-2-1-3-6(9)4-5/h2,4,9H,1,3H2,(H2,8,10) |
| InChIKey | HSKNWCYRUUJXSJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxycyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxycyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of 5-hydroxycyclohexa-1,5-diene-1-carboxamide (CID 89094730) is 5-hydroxycyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for 5-hydroxycyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for 5-hydroxycyclohexa-1,5-diene-1-carboxamide is NC(=O)C1=CCCC(O)=C1.
What is the InChIKey of 5-hydroxycyclohexa-1,5-diene-1-carboxamide?
The InChIKey is HSKNWCYRUUJXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c8-7(10)5-2-1-3-6(9)4-5/h2,4,9H,1,3H2,(H2,8,10).
What are the key properties of 5-hydroxycyclohexa-1,5-diene-1-carboxamide?
5-hydroxycyclohexa-1,5-diene-1-carboxamide has a molecular weight of 139.15 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxycyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 89094730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).