C7H9NO2 — CID 89094730
5-hydroxycyclohexa-1,5-diene-1-carboxamide (PubChem CID 89094730) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 5-hydroxycyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 5-hydroxycyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 89094730 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 5-hydroxycyclohexa-1,5-diene-1-carboxamide |
| SMILES | NC(=O)C1=CCCC(O)=C1 |
| InChI | InChI=1S/C7H9NO2/c8-7(10)5-2-1-3-6(9)4-5/h2,4,9H,1,3H2,(H2,8,10) |
| InChIKey | HSKNWCYRUUJXSJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |