C13H27NO2 — CID 144833562
ethane;1-[5-[(hydroxyamino)methyl]cyclohexa-1,5-dien-1-yl]ethanone;molecular hydrogen (PubChem CID 144833562) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is ethane;1-[5-[(hydroxyamino)methyl]cyclohexa-1,5-dien-1-yl]ethanone;molecular hydrogen.
| Compound Name | ethane;1-[5-[(hydroxyamino)methyl]cyclohexa-1,5-dien-1-yl]ethanone;molecular hydrogen |
|---|---|
| PubChem CID | 144833562 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | ethane;1-[5-[(hydroxyamino)methyl]cyclohexa-1,5-dien-1-yl]ethanone;molecular hydrogen |
| SMILES | CC.CC.CC(=O)C1=CCCC(CNO)=C1.[H][H] |
| InChI | InChI=1S/C9H13NO2.2C2H6.H2/c1-7(11)9-4-2-3-8(5-9)6-10-12;2*1-2;/h4-5,10,12H,2-3,6H2,1H3;2*1-2H3;1H |
| InChIKey | NUYCCPMZBZOKHT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|