C14H23NO — CID 58849784
1-(3-methyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrol-2-yl)ethanone (PubChem CID 58849784) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(3-methyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrol-2-yl)ethanone.
| Compound Name | 1-(3-methyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 58849784 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(3-methyl-2,3a,4,4a,5,6,7,8,8a,8b-decahydro-1H-indeno[2,1-b]pyrrol-2-yl)ethanone |
| SMILES | CC(=O)C1CC2C3CCCCC3CC2N1C |
| InChI | InChI=1S/C14H23NO/c1-9(16)13-8-12-11-6-4-3-5-10(11)7-14(12)15(13)2/h10-14H,3-8H2,1-2H3 |
| InChIKey | ZPRZWFMMXITIEN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |